Fexoy + h2so4 đặc nóng

Tất cả Lớp 12 Lớp 11 Lớp 10 Lớp 9 Lớp 8 Lớp 7 Lớp 6 Lớp 5 Lớp 4 Lớp 3 Lớp 2 Lớp 1

Bạn đang xem: Fexoy + h2so4 đặc nóng


2 | xFe(+2y/x) -----> xFe(+3) +(3x-2y)e 3x-2y| S(+6)+2e->S(+4) =>2FexOy+(6x-2y)H2So4-> xFe2(SO4)3 + (3x-2y) SO2+ (6x-2y)H20

Cân bằng phương thơm trình này hộ mk nha:

a. FexOy + H2SO4 = Fe2(SO4)3 + S + H2O

b. FexOy + H2SO4 = Fe2(SO4)3 + H2S + H2O

c. FexOy + H2SO4 = Fe2(SO4)3 + NO2 + H2O

d. FexOy + H2SO4 = Fe2(SO4)3 + NO + H2O

e.FexOy + H2SO4 = Fe2(SO4)3 + N2O + H2O

FexOy + H2SO4 = Fe2(SO4)3 + N2+ H2O

FexOy + H2SO4 = Fe2(SO4)3 + NH4NO3 + H2O

b. 8 FexOy + (15x -2y) H2SO4 = 4xFe2(SO4)3 + (3x-2y) H2S +12x H2O

a. 6 FexOy + (12x-2y) H2SO4 =3x Fe2(SO4)3 + (3x-2y)S + (12x-2y) H2O


Fe(OH)2+H2SO4 sệt rét ----->Fe2(SO4)3+SO2+H2OCu2O+HNO3---->Cu(NO3)2+NH4NO3+H2OFexOy+H2SO4---->Fe2(SO4)3+SO2+H2OFexOy+HNO3---->Fe(NO3)2+NO2+H2OFexOy+NO3---->Fe(NO3)3+NtOz+H2O

2Fe(OH)2 + 4H2SO4 ---> Fe2(SO4)3 + SO2 + 6H2O4Cu2O + 18HNO3 ---> 8Cu(NO3)2 + NH4NO3 + 7H2O4FexOy + (12x-4y) H2SO4 ---> 2x Fe2(SO4)3 + (6x-4y) SO2 + (12x-4y) H2OFexOy + (4x-2y) HNO3 ---> x Fe(NO3)2 + (2x-2y) NO2 + (2x-y) H2O(5t-2z) FexOy + (18xt - 2yt - 6xz) HNO3---> (5tx-2zx) Fe(NO3)3 + (3x-2y) NtOz + (9xt-yt-3xz) H2O

Lập các bước lập phương trình phản ứng thoái hóa khử sau :

MnCl2+HCl -) MnCl2+Cl+H2O

Al+HNO3 -) Al(NO3)3+NH4NO3+H2O

Fe3O4+H2SO4 -) Fe2(SO4)3+S+H2O

Fe3O4+H2SO4 -) Fe(SO4)3+SO2+H2O

FexOy+HNO3 -) Fe(NO3)3+NO+H20

FexOy+H2SO4 -) Fe2(SO4)3+SO2+H2O

NH4NO3 -) N2O+H2O

NH4NO2 -) N2+H2O

Cl2+KOH -) KClO3+H2O

KMnO4+HCl -) KCl+MnCl2+Cl2+H2O

Mk có tác dụng ví dụ 3 ý đầu nhé mấy ý sau tương tự

MnO2+HCl( ightarrow)MnCl2+Cl2+H2O

Mn+4 +2e( ightarrow)Mn+2_____.1

2Cl- ( ightarrow)Cl2+2e________.1

( ightarrow)MnO2+4HCl( ightarrow)MnCl2+Cl2+2H2O

Al( ightarrow)Al+3 +3e ______.8

N+5 +8e( ightarrow)N-3______.3

( ightarrow)8Al+30HNO3( ightarrow)8Al(NO3)3+3NH4NO3+15H2O

6Fe+(frac83 ightarrow)6Fe+3 +2e ___________.3

S+6 +6e( ightarrow)S0 ________________ .1

( ightarrow)6Fe3O4+28H2SO4( ightarrow)9Fe2(SO4)3+S+28H2O


Xem thêm: How To A Typical Day In My Life, What'S Your Typical Day Like

cân đối pthh sau:

1, FexOy + H2SO4 -> Fe2(SO4)3 + SO2 + H2O

2, M +HNO3 -> M(NO3)n + NO2+ H2O

3, M + HNO3 -> M(NO3)3 +NO +H2O

4, MO +H2SO4 -> M2(SO4)3 + SO2 + H2O

mk chỉ ghi thông số thôi nha

2, 0 - 2n - 0 - n - n

3, 0 - 4 - 0 - 0 - 2

4, 2 - 4 - 0 - 0 - 4

câu 1 tuồng như đề bị không đúng giỏi sao kia bn

Dùng phương pháp cân bằng electron : a, FeSO4 + H2SO4 -> Fe2(SO4) + SO2↑ + H2O b, Fe3O4 + H2SO -> Fe2(SO4)3 + SO2↑ + H2O Giupws mình cùng với ạ, buộc phải gấp lắm ạ

Giải mê thích quá trình giải:


->3FexOy+(3y-4x)CO----khổng lồ , xt (cóthể bao gồm )-->xFe3O4+(4y-3x)CO


1. K2Cr2O7 + H2SO4 + FeSO4 -> Cr2(SO4)3 + Fe2(SO4)3 + K2SO4 + H2O

2. Fe3O4 + HNO3 -> Fe(NO3)3 + NO + H2O

3. Cr2O3 + KNO3 + KOH -> K2CrO4 + KNO2 + H2O

4. KMnO4 + KNO2 + H2SO4 -> MnSO4 + K2SO4 + KNO3 + H2O

5. NaCrO2 + Br2 + NaOH -> Na2CrO4 + NaBr + H2O

6. Ca3(PO4)2 + C + SiO2 -> P + CaSiO3 + CO

7. KclO3 + NH3 -> KNO3 + KCl + H2O + Cl2

8. FeCl2 + H2O2 + HCl -> FeCl3 + H2O

9. KNO3 + FeS -> KNO2 + Fe2O3 + SO3

10. H2O2 + KMnO4 + H2SO4 -> O2 + K2SO4 + MnSO4+ H2O

11. FexOy + H2SO4 -> Fe2(SO4)3 + SO2 + H2O

12. Fe3O4 + HNO 3 -> Fe(NO3)3 + NxOy + H2O

13. FeS2 + H2SO4 -> Fe2(SO4)3 + SO2 + H2O

14. FeS2 + HNO 3 -> Fe(NO3)3 + H2SO4 + NO2 + H2O

15. FeS2 + HNO 3 -> Fe(NO3)3 + H2SO4 + NO + H2O

16. FeSO4 + HNO3 -> Fe(NO3)3 + Fe2(SO4)3 + NO + H2O

Lớp 10 Hóa học Ôn tập cuối học tập kì II
Gửi Hủy


Đúng 0

Xem thêm: Tặng Acc Ngọc Rồng 2021: Cho Nick Ngọc Rồng 24 Tỷ, Cho Nick Ngọc Rồng Online Miễn Phí

Bình luận (0)

Chuyên mục: Kiến thức thú vị