đáp án đề thi violympic toán lớp 7 vòng 15 năm 2016

Các dạng tân oán trong đề thi Violympic tân oán lớp 7

Các dạng tân oán luyện thi Violympic lớp 7 là cỗ đề ôn luyện tổng hòa hợp nhưng tinycollege.edu.vn sẽ dày công đọc với trình làng dành riêng cho những em học sinh lớp 7 giúp các em đọc thêm các dạng đề Toán thù, tự ôn luyện kỹ năng trước khi phi vào kỳ thi giải Tân oán qua mạng Internet. Mời các em thuộc xem thêm.

Bạn đang xem: đáp án đề thi violympic toán lớp 7 vòng 15 năm 2016

Đề thi Violympic Tân oán lớp 7 vòng 12 năm 2015 - 2016

Đề thi Violympic Toán thù lớp 7 vòng 15 năm năm 2016 - 2017

Dạng 1: Dãy số cơ mà những số hạng cách đầy đủ.

Xem thêm: Phân Tích Diễn Biến Tâm Trạng Thúy Kiều Trong Trao Duyên Siêu Hay

Bài 1: Tính B = 1 + 2+ 3+ ...+ 98+99

B = 1 + (2 + 3 + 4+...+ 98 + 99). Ta thấy tổng vào ngoặc tất cả 98 số hạng, giả dụ tạo thành các cặp ta bao gồm 49 cặp bắt buộc tổng kia là:

(2 + 99) + (3 + 98) +..+ (51 + 50) = 49.101 = 4949 khi ấy B = 1 + 4949 = 4950


Bài 2: Tính C = 1 + 3 + 5 +...+ 997 + 999

Từ 1 cho 1000 có 500 số chẵn với 500 số lẻ yêu cầu tổng bên trên gồm 500 số lẻ. Áp dụng những bài xích trên ta có

C = (1 + 999) + (3 + 997)+...+ (499 + 501)= 1000.250 = 250000 (Tổng trên có 250 cặp số)

Dạng 2: Dãy số mà những số hạng không bí quyết gần như.

Xem thêm: 11 Hot Girl Xinh Đẹp Nhất Việt Nam Nổi Tiếng Xinh Đẹp Dễ Thương Nhất 2020

Bài 1: Tính A = 1.2 + 2.3 + 3.4 +...+ n.(n+1)

Lời giải

Ta có

3A = 1.2.3 + 2.3.3 +...+ n(n + 1).3 = 1.2.(3-0) + 2.3.(3 - 1 )+...+ n(n + 1)<(n-2)-(n-1)>

=1.2.3 - 1.2.0 + 2.3.3 - 1.2.3 +...+ n(n+1)(n-2)-(n-1)n(n+1)=n(n+1)(n+2)

=> A = n(n+1)(n+2)/3

* Tổng quát hóa ta có:

k(k+1)(k+2)-(k-1)(k+1)= 3k(k+1). Trong số đó k= 1;2;3...

Ta dễ dàng chứng minh cách làm bên trên như sau:

K(k+1)(k+2)-(k-1)(k+1)=k(k+1)<(k+2)-(k-1)>= 3k(k+1)

Bài 2. Tính B = 1.2.3 + 2.3.4 +....+ (n-1)n(n+1)

Lời giải

Áp dụng tính kế thừa của bài bác 1 ta có:

4B= 1.2.3.4 + 2.3.4.4 +...+ (n-1)n(n+1).4

= 1.2.3.4 - 0.1.2.3 + 2.3.4.5-1.2.3.4 +...+ (n-1)n(n+1)(n+2)-<(n-2)(n-1)n(n+1)>


= (n-1)n(n+1)(n+2)-0.1.2.3 = (n-1)n(n+1)(n+2)

=> B = (n-1)n(n+1)(n+2)/4


Đánh giá bán bài viết
121 27.567
Chia sẻ bài viết
Tải về Bản in
Tmê mệt khảo thêm
0 Bình luận
Sắp xếp theo Mặc định Mới duy nhất Cũ độc nhất vô nhị
*
Luyện thi
Giới thiệu Chính sách Theo dõi Cửa Hàng chúng tôi Tải vận dụng Chứng thừa nhận
*

meta.vn. Giấy phxay số 366/GP-BTTTT bởi vì Sở TTTT cung cấp.

Chuyên mục: Kiến thức thú vị